C31H30N4O4S — CID 17112990
N-(4-anilinophenyl)-2-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 17112990) has the molecular formula C31H30N4O4S and a molecular weight of 554.67 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 17112990 |
| Molecular Formula | C31H30N4O4S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[4-(2-ethoxyethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H30N4O4S/c1-2-38-20-21-39-26-18-12-22(13-19-26)29(36)35-31(40)34-28-11-7-6-10-27(28)30(37)33-25-16-14-24(15-17-25)32-23-8-4-3-5-9-23/h3-19,32H,2,20-21H2,1H3,(H,33,37)(H2,34,35,36,40) |
| InChIKey | QCQCEJOGBKLMHP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|