C18H15N3O3S2 — CID 28638535
N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 28638535) has the molecular formula C18H15N3O3S2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 28638535 |
| Molecular Formula | C18H15N3O3S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(NC(=S)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H15N3O3S2/c22-16(19-11-14-3-1-9-24-14)12-5-7-13(8-6-12)20-18(25)21-17(23)15-4-2-10-26-15/h1-10H,11H2,(H,19,22)(H2,20,21,23,25) |
| InChIKey | NXQGTMUBODYGIN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|