C17H15N3O4S3 — CID 17171029
N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 17171029) has the molecular formula C17H15N3O4S3 and a molecular weight of 421.53 g/mol. Its IUPAC name is N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17171029 |
| Molecular Formula | C17H15N3O4S3 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1)c1cccs1 |
| InChI | InChI=1S/C17H15N3O4S3/c21-16(15-4-2-10-26-15)20-17(25)19-12-5-7-14(8-6-12)27(22,23)18-11-13-3-1-9-24-13/h1-10,18H,11H2,(H2,19,20,21,25) |
| InChIKey | NAAYPPQJUKRCFO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|