C15H15N3O3S3 — CID 4930046
N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 4930046) has the molecular formula C15H15N3O3S3 and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4930046 |
| Molecular Formula | C15H15N3O3S3 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H15N3O3S3/c1-2-9-16-24(20,21)12-7-5-11(6-8-12)17-15(22)18-14(19)13-4-3-10-23-13/h2-8,10,16H,1,9H2,(H2,17,18,19,22) |
| InChIKey | RTEZUDDDBZOLQU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|