C20H21N3O4S2 — CID 6233562
(E)-3-(2-methoxyphenyl)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 6233562) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6233562 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=S)NC(=O)/C=C/c2ccccc2OC)cc1 |
| InChI | InChI=1S/C20H21N3O4S2/c1-3-14-21-29(25,26)17-11-9-16(10-12-17)22-20(28)23-19(24)13-8-15-6-4-5-7-18(15)27-2/h3-13,21H,1,14H2,2H3,(H2,22,23,24,28)/b13-8+ |
| InChIKey | SQGHKTHNHLSIMY-MDWZMJQESA-N |
| XLogP | 2.69 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|