C23H27N3O4S2 — CID 4036400
N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 4036400) has the molecular formula C23H27N3O4S2 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4036400 |
| Molecular Formula | C23H27N3O4S2 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1C=CC(=O)NC(=S)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H27N3O4S2/c1-30-21-10-6-5-7-17(21)11-16-22(27)25-23(31)24-18-12-14-20(15-13-18)32(28,29)26-19-8-3-2-4-9-19/h5-7,10-16,19,26H,2-4,8-9H2,1H3,(H2,24,25,27,31) |
| InChIKey | QXGYYTWQOAGOQT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|