C15H21N3O3S2 — CID 4930104
3-methyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]butanamide (PubChem CID 4930104) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is 3-methyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]butanamide.
| Compound Name | 3-methyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 4930104 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-methyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]butanamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=S)NC(=O)CC(C)C)cc1 |
| InChI | InChI=1S/C15H21N3O3S2/c1-4-9-16-23(20,21)13-7-5-12(6-8-13)17-15(22)18-14(19)10-11(2)3/h4-8,11,16H,1,9-10H2,2-3H3,(H2,17,18,19,22) |
| InChIKey | BEAMTSWOIYVIPE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|