C17H23N3O3S2 — CID 54786315
2-cyclopentyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]acetamide (PubChem CID 54786315) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54786315 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-cyclopentyl-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]acetamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=S)NC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C17H23N3O3S2/c1-2-11-18-25(22,23)15-9-7-14(8-10-15)19-17(24)20-16(21)12-13-5-3-4-6-13/h2,7-10,13,18H,1,3-6,11-12H2,(H2,19,20,21,24) |
| InChIKey | OPWYEUZHEKTWLL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|