C20H27N3O2S — CID 54786669
2-cyclopentyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]acetamide (PubChem CID 54786669) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-cyclopentyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54786669 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-cyclopentyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(CC1CCCC1)NC(=S)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H27N3O2S/c24-18(14-15-6-2-3-7-15)22-20(26)21-17-10-8-16(9-11-17)19(25)23-12-4-1-5-13-23/h8-11,15H,1-7,12-14H2,(H2,21,22,24,26) |
| InChIKey | CMXKAKMGDHAUJP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|