C19H28N3O2+ — CID 7406351
cyclopentyl-[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]azanium (PubChem CID 7406351) has the molecular formula C19H28N3O2+ and a molecular weight of 330.45 g/mol. Its IUPAC name is cyclopentyl-[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]azanium.
| Compound Name | cyclopentyl-[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 7406351 |
| Molecular Formula | C19H28N3O2+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | cyclopentyl-[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]azanium |
| SMILES | O=C(C[NH2+]C1CCCC1)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27N3O2/c23-18(14-20-16-6-2-3-7-16)21-17-10-8-15(9-11-17)19(24)22-12-4-1-5-13-22/h8-11,16,20H,1-7,12-14H2,(H,21,23)/p+1 |
| InChIKey | CUJPKMWWYKQALQ-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |