C22H31N3O2S — CID 26168099
3-cyclohexyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide (PubChem CID 26168099) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 3-cyclohexyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 26168099 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-cyclohexyl-N-[[4-(piperidine-1-carbonyl)phenyl]carbamothioyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H31N3O2S/c26-20(14-9-17-7-3-1-4-8-17)24-22(28)23-19-12-10-18(11-13-19)21(27)25-15-5-2-6-16-25/h10-13,17H,1-9,14-16H2,(H2,23,24,26,28) |
| InChIKey | AJQCRLMOIVYENC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|