C21H31N3O3S — CID 17205331
4-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methoxypropyl)benzamide (PubChem CID 17205331) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 4-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 17205331 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 4-(3-cyclohexylpropanoylcarbamothioylamino)-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=S)NC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C21H31N3O3S/c1-27-15-5-14-22-20(26)17-9-11-18(12-10-17)23-21(28)24-19(25)13-8-16-6-3-2-4-7-16/h9-12,16H,2-8,13-15H2,1H3,(H,22,26)(H2,23,24,25,28) |
| InChIKey | GJCYKIVFTNKOBD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|