C21H28N4O3S — CID 4934825
N-[4-[(3-cyclohexylpropanoylcarbamothioylamino)carbamoyl]phenyl]cyclopropanecarboxamide (PubChem CID 4934825) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[4-[(3-cyclohexylpropanoylcarbamothioylamino)carbamoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(3-cyclohexylpropanoylcarbamothioylamino)carbamoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 4934825 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-[4-[(3-cyclohexylpropanoylcarbamothioylamino)carbamoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)NNC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H28N4O3S/c26-18(13-6-14-4-2-1-3-5-14)23-21(29)25-24-20(28)16-9-11-17(12-10-16)22-19(27)15-7-8-15/h9-12,14-15H,1-8,13H2,(H,22,27)(H,24,28)(H2,23,25,26,29) |
| InChIKey | XPBKBTZSPCUWHT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|