C18H24N4O3S — CID 4507491
N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]cyclohexanecarboxamide (PubChem CID 4507491) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]cyclohexanecarboxamide.
| Compound Name | N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4507491 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]cyclohexanecarboxamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-2-15(23)19-14-10-8-13(9-11-14)17(25)21-22-18(26)20-16(24)12-6-4-3-5-7-12/h8-12H,2-7H2,1H3,(H,19,23)(H,21,25)(H2,20,22,24,26) |
| InChIKey | OXRFTXATAIUEQS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|