C20H28N4O3S — CID 54786933
N-[4-[[(2-cyclopentylacetyl)carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide (PubChem CID 54786933) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[4-[[(2-cyclopentylacetyl)carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[[(2-cyclopentylacetyl)carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 54786933 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[4-[[(2-cyclopentylacetyl)carbamothioylamino]carbamoyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C20H28N4O3S/c1-13(2)11-17(25)21-16-9-7-15(8-10-16)19(27)23-24-20(28)22-18(26)12-14-5-3-4-6-14/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,21,25)(H,23,27)(H2,22,24,26,28) |
| InChIKey | GNJQDMIVEAOUTQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|