C16H21N3O3 — CID 54786522
N-[4-[[(2-cyclopentylacetyl)amino]carbamoyl]phenyl]acetamide (PubChem CID 54786522) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[4-[[(2-cyclopentylacetyl)amino]carbamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(2-cyclopentylacetyl)amino]carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 54786522 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[4-[[(2-cyclopentylacetyl)amino]carbamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=O)CC2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-11(20)17-14-8-6-13(7-9-14)16(22)19-18-15(21)10-12-4-2-3-5-12/h6-9,12H,2-5,10H2,1H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | LJQBVMZLVBPMOU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|