C15H20N2O3 — CID 104927556
4-acetamido-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide (PubChem CID 104927556) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-acetamido-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 4-acetamido-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 104927556 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 4-acetamido-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C15H20N2O3/c1-10(18)16-12-8-6-11(7-9-12)15(20)17-13-4-2-3-5-14(13)19/h6-9,13-14,19H,2-5H2,1H3,(H,16,18)(H,17,20)/t13-,14-/m1/s1 |
| InChIKey | ZGEUVNYXBNKTBH-ZIAGYGMSSA-N |
| XLogP | 1.68 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |