C13H16ClNO2 — CID 40617766
4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide (PubChem CID 40617766) has the molecular formula C13H16ClNO2 and a molecular weight of 253.73 g/mol. Its IUPAC name is 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 40617766 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-chloro-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClNO2/c14-10-7-5-9(6-8-10)13(17)15-11-3-1-2-4-12(11)16/h5-8,11-12,16H,1-4H2,(H,15,17)/t11-,12-/m1/s1 |
| InChIKey | IZBVTTZIHOWTSB-VXGBXAGGSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |