C14H18ClNO2 — CID 104956646
3-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide (PubChem CID 104956646) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 3-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 104956646 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-chloro-N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CCCC[C@@H]2O)cc1Cl |
| InChI | InChI=1S/C14H18ClNO2/c1-9-6-7-10(8-11(9)15)14(18)16-12-4-2-3-5-13(12)17/h6-8,12-13,17H,2-5H2,1H3,(H,16,18)/t12-,13-/m0/s1 |
| InChIKey | KVOXVOHWFXFIJS-STQMWFEESA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |