C14H16ClNO4 — CID 155912978
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-chloro-4-methylbenzamide (PubChem CID 155912978) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-chloro-4-methylbenzamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-chloro-4-methylbenzamide |
|---|---|
| PubChem CID | 155912978 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-chloro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4/c1-7-2-3-8(4-9(7)15)14(18)16-10-5-19-13-11(17)6-20-12(10)13/h2-4,10-13,17H,5-6H2,1H3,(H,16,18)/t10-,11+,12+,13+/m0/s1 |
| InChIKey | CUQBYMLLUOFCNG-UMSGYPCISA-N |
| XLogP | 0.91 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |