C22H22N2O5 — CID 175644184
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)naphthalene-2-carboxamide (PubChem CID 175644184) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)naphthalene-2-carboxamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 175644184 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-5-(3,5-dimethyl-1,2-oxazol-4-yl)naphthalene-2-carboxamide |
| SMILES | Cc1noc(C)c1-c1cccc2cc(C(=O)N[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)ccc12 |
| InChI | InChI=1S/C22H22N2O5/c1-11-19(12(2)29-24-11)16-5-3-4-13-8-14(6-7-15(13)16)22(26)23-17-9-27-21-18(25)10-28-20(17)21/h3-8,17-18,20-21,25H,9-10H2,1-2H3,(H,23,26)/t17-,18-,20-,21-/m1/s1 |
| InChIKey | HNZQDJIQWMLPPJ-VURPSTOHSA-N |
| XLogP | 2.37 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |