C15H15ClN2O4 — CID 156584209
N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-chloro-1H-indole-2-carboxamide (PubChem CID 156584209) has the molecular formula C15H15ClN2O4 and a molecular weight of 322.75 g/mol. Its IUPAC name is N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-chloro-1H-indole-2-carboxamide.
| Compound Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-chloro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 156584209 |
| Molecular Formula | C15H15ClN2O4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-chloro-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O)c1cc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C15H15ClN2O4/c16-8-2-1-3-9-7(8)4-10(17-9)15(20)18-11-5-21-14-12(19)6-22-13(11)14/h1-4,11-14,17,19H,5-6H2,(H,18,20)/t11-,12+,13+,14+/m0/s1 |
| InChIKey | TUIPLJZGVFUZJF-REWJHTLYSA-N |
| XLogP | 1.08 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |