C16H17FN2O4 — CID 157016049
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-7-fluoro-3-methyl-1H-indole-2-carboxamide (PubChem CID 157016049) has the molecular formula C16H17FN2O4 and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-7-fluoro-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-7-fluoro-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 157016049 |
| Molecular Formula | C16H17FN2O4 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-7-fluoro-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C16H17FN2O4/c1-7-8-3-2-4-9(17)13(8)19-12(7)16(21)18-10-5-22-15-11(20)6-23-14(10)15/h2-4,10-11,14-15,19-20H,5-6H2,1H3,(H,18,21)/t10-,11-,14-,15-/m1/s1 |
| InChIKey | NNWVAAIGMWMVJO-YIKOMLBNSA-N |
| XLogP | 0.87 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|