C16H19FN2O3 — CID 91779136
7-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methyl-1H-indole-2-carboxamide (PubChem CID 91779136) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 7-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 7-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91779136 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 7-fluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methyl-1H-indole-2-carboxamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)c1[nH]c2c(F)cccc2c1C |
| InChI | InChI=1S/C16H19FN2O3/c1-9-10-4-3-5-11(17)15(10)19-14(9)16(20)18-12-6-7-22-8-13(12)21-2/h3-5,12-13,19H,6-8H2,1-2H3,(H,18,20)/t12-,13-/m1/s1 |
| InChIKey | SSQILWOKNJSDJV-CHWSQXEVSA-N |
| XLogP | 2.15 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|