C15H18F3NO3 — CID 91777227
N-[(3S,4R)-3-methoxyoxan-4-yl]-2-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 91777227) has the molecular formula C15H18F3NO3 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-[(3S,4R)-3-methoxyoxan-4-yl]-2-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-2-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91777227 |
| Molecular Formula | C15H18F3NO3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-2-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO3/c1-21-13-9-22-7-6-12(13)19-14(20)8-10-4-2-3-5-11(10)15(16,17)18/h2-5,12-13H,6-9H2,1H3,(H,19,20)/t12-,13-/m1/s1 |
| InChIKey | WKRNHSYJVILZRD-CHWSQXEVSA-N |
| XLogP | 2.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |