C21H24N2O3 — CID 91772197
N-[(3R,4R)-4-methoxyoxan-3-yl]-2-(9-methylcarbazol-3-yl)acetamide (PubChem CID 91772197) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[(3R,4R)-4-methoxyoxan-3-yl]-2-(9-methylcarbazol-3-yl)acetamide.
| Compound Name | N-[(3R,4R)-4-methoxyoxan-3-yl]-2-(9-methylcarbazol-3-yl)acetamide |
|---|---|
| PubChem CID | 91772197 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[(3R,4R)-4-methoxyoxan-3-yl]-2-(9-methylcarbazol-3-yl)acetamide |
| SMILES | CO[C@@H]1CCOC[C@H]1NC(=O)Cc1ccc2c(c1)c1ccccc1n2C |
| InChI | InChI=1S/C21H24N2O3/c1-23-18-6-4-3-5-15(18)16-11-14(7-8-19(16)23)12-21(24)22-17-13-26-10-9-20(17)25-2/h3-8,11,17,20H,9-10,12-13H2,1-2H3,(H,22,24)/t17-,20-/m1/s1 |
| InChIKey | KIYUHGOPUJGBEM-YLJYHZDGSA-N |
| XLogP | 2.79 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |