C17H25NO6 — CID 91761693
N-[(3S,4R)-3-methoxyoxan-4-yl]-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 91761693) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[(3S,4R)-3-methoxyoxan-4-yl]-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 91761693 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(3S,4R)-3-methoxyoxan-4-yl]-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)N[C@@H]2CCOC[C@H]2OC)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO6/c1-20-13-7-11(8-14(21-2)17(13)23-4)9-16(19)18-12-5-6-24-10-15(12)22-3/h7-8,12,15H,5-6,9-10H2,1-4H3,(H,18,19)/t12-,15-/m1/s1 |
| InChIKey | IOIWZMBYFZFEQD-IUODEOHRSA-N |
| XLogP | 1.17 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |