C18H25NO7 — CID 120547869
2-(oxan-3-yl)-2-[[2-(3,4,5-trimethoxyphenyl)acetyl]amino]acetic acid (PubChem CID 120547869) has the molecular formula C18H25NO7 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[[2-(3,4,5-trimethoxyphenyl)acetyl]amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[[2-(3,4,5-trimethoxyphenyl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120547869 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-(oxan-3-yl)-2-[[2-(3,4,5-trimethoxyphenyl)acetyl]amino]acetic acid |
| SMILES | COc1cc(CC(=O)NC(C(=O)O)C2CCCOC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H25NO7/c1-23-13-7-11(8-14(24-2)17(13)25-3)9-15(20)19-16(18(21)22)12-5-4-6-26-10-12/h7-8,12,16H,4-6,9-10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | JMPFUYATNBPQLD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |