C19H27NO4 — CID 120548583
2-[5-(4-methylphenyl)pentanoylamino]-2-(oxan-3-yl)acetic acid (PubChem CID 120548583) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)pentanoylamino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[5-(4-methylphenyl)pentanoylamino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120548583 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-[5-(4-methylphenyl)pentanoylamino]-2-(oxan-3-yl)acetic acid |
| SMILES | Cc1ccc(CCCCC(=O)NC(C(=O)O)C2CCCOC2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-14-8-10-15(11-9-14)5-2-3-7-17(21)20-18(19(22)23)16-6-4-12-24-13-16/h8-11,16,18H,2-7,12-13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | YEKIYVQUZWCAFO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|