C13H18N2O4S — CID 120547636
2-(oxan-3-yl)-2-[3-(1,3-thiazol-2-yl)propanoylamino]acetic acid (PubChem CID 120547636) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[3-(1,3-thiazol-2-yl)propanoylamino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[3-(1,3-thiazol-2-yl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 120547636 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(oxan-3-yl)-2-[3-(1,3-thiazol-2-yl)propanoylamino]acetic acid |
| SMILES | O=C(CCc1nccs1)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C13H18N2O4S/c16-10(3-4-11-14-5-7-20-11)15-12(13(17)18)9-2-1-6-19-8-9/h5,7,9,12H,1-4,6,8H2,(H,15,16)(H,17,18) |
| InChIKey | CAYDQRPQHPULEC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |