C14H18N2O5S — CID 120547564
2-(oxan-3-yl)-2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetic acid (PubChem CID 120547564) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120547564 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(oxan-3-yl)-2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetic acid |
| SMILES | O=C(CNC(=O)c1cccs1)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C14H18N2O5S/c17-11(7-15-13(18)10-4-2-6-22-10)16-12(14(19)20)9-3-1-5-21-8-9/h2,4,6,9,12H,1,3,5,7-8H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | GITOBRLZERVLID-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |