C15H17BrFNO4 — CID 120547485
2-[[2-(3-bromo-4-fluorophenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547485) has the molecular formula C15H17BrFNO4 and a molecular weight of 374.21 g/mol. Its IUPAC name is 2-[[2-(3-bromo-4-fluorophenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[2-(3-bromo-4-fluorophenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547485 |
| Molecular Formula | C15H17BrFNO4 |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2-[[2-(3-bromo-4-fluorophenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(Cc1ccc(F)c(Br)c1)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C15H17BrFNO4/c16-11-6-9(3-4-12(11)17)7-13(19)18-14(15(20)21)10-2-1-5-22-8-10/h3-4,6,10,14H,1-2,5,7-8H2,(H,18,19)(H,20,21) |
| InChIKey | ODZAISLAMNVLDG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |