C16H19F2NO5 — CID 120548357
2-[2-(3,4-difluorophenoxy)propanoylamino]-2-(oxan-3-yl)acetic acid (PubChem CID 120548357) has the molecular formula C16H19F2NO5 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenoxy)propanoylamino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[2-(3,4-difluorophenoxy)propanoylamino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120548357 |
| Molecular Formula | C16H19F2NO5 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[2-(3,4-difluorophenoxy)propanoylamino]-2-(oxan-3-yl)acetic acid |
| SMILES | CC(Oc1ccc(F)c(F)c1)C(=O)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C16H19F2NO5/c1-9(24-11-4-5-12(17)13(18)7-11)15(20)19-14(16(21)22)10-3-2-6-23-8-10/h4-5,7,9-10,14H,2-3,6,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | SXJKADDEZGULGK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |