C17H23NO6 — CID 120690226
2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120690226) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120690226 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | COc1ccc(OC)c(CC(=O)NC(C(=O)O)C2CCCOC2)c1 |
| InChI | InChI=1S/C17H23NO6/c1-22-13-5-6-14(23-2)12(8-13)9-15(19)18-16(17(20)21)11-4-3-7-24-10-11/h5-6,8,11,16H,3-4,7,9-10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | CCQPOOHILGAJTF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |