C16H19N5O4 — CID 120548158
2-(oxan-3-yl)-2-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]acetic acid (PubChem CID 120548158) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-(oxan-3-yl)-2-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]acetic acid.
| Compound Name | 2-(oxan-3-yl)-2-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 120548158 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(oxan-3-yl)-2-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]acetic acid |
| SMILES | O=C(Cc1ccc(-n2cnnn2)cc1)NC(C(=O)O)C1CCCOC1 |
| InChI | InChI=1S/C16H19N5O4/c22-14(18-15(16(23)24)12-2-1-7-25-9-12)8-11-3-5-13(6-4-11)21-10-17-19-20-21/h3-6,10,12,15H,1-2,7-9H2,(H,18,22)(H,23,24) |
| InChIKey | NCIOQXSAOCLIEY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |