C17H21N7O3 — CID 167935083
N-carbamoyl-4-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 167935083) has the molecular formula C17H21N7O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-carbamoyl-4-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-carbamoyl-4-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167935083 |
| Molecular Formula | C17H21N7O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-carbamoyl-4-[[2-[4-(tetrazol-1-yl)phenyl]acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)NC(=O)C1CCC(NC(=O)Cc2ccc(-n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C17H21N7O3/c18-17(27)21-16(26)12-3-5-13(6-4-12)20-15(25)9-11-1-7-14(8-2-11)24-10-19-22-23-24/h1-2,7-8,10,12-13H,3-6,9H2,(H,20,25)(H3,18,21,26,27) |
| InChIKey | GURAPPOJEHQZQY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |