C17H25ClN6O — CID 119591477
N-(2-amino-1-cyclohexylethyl)-2-[4-(tetrazol-1-yl)phenyl]acetamide;hydrochloride (PubChem CID 119591477) has the molecular formula C17H25ClN6O and a molecular weight of 364.88 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-[4-(tetrazol-1-yl)phenyl]acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-[4-(tetrazol-1-yl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119591477 |
| Molecular Formula | C17H25ClN6O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-[4-(tetrazol-1-yl)phenyl]acetamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)Cc1ccc(-n2cnnn2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C17H24N6O.ClH/c18-11-16(14-4-2-1-3-5-14)20-17(24)10-13-6-8-15(9-7-13)23-12-19-21-22-23;/h6-9,12,14,16H,1-5,10-11,18H2,(H,20,24);1H |
| InChIKey | SFOPAYYUCCFCNM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |