C19H20N6O3S — CID 55847022
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 55847022) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 55847022 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-2-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(-n2cnnn2)cc1)NCc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C19H20N6O3S/c26-19(11-14-1-7-17(8-2-14)25-13-21-23-24-25)20-12-15-3-9-18(10-4-15)29(27,28)22-16-5-6-16/h1-4,7-10,13,16,22H,5-6,11-12H2,(H,20,26) |
| InChIKey | UIHUGOKODCEVPG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |