C17H18FN3O4 — CID 120547481
2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-(oxan-3-yl)acetic acid (PubChem CID 120547481) has the molecular formula C17H18FN3O4 and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-(oxan-3-yl)acetic acid.
| Compound Name | 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-(oxan-3-yl)acetic acid |
|---|---|
| PubChem CID | 120547481 |
| Molecular Formula | C17H18FN3O4 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-(oxan-3-yl)acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CCCOC1)c1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C17H18FN3O4/c18-12-3-5-13(6-4-12)21-8-7-14(20-21)16(22)19-15(17(23)24)11-2-1-9-25-10-11/h3-8,11,15H,1-2,9-10H2,(H,19,22)(H,23,24) |
| InChIKey | BZSIKAXOPDOCOJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |