C14H20N2O3 — CID 91774545
1-cyclopropyl-N-[(3R,4R)-4-methoxyoxan-3-yl]pyrrole-2-carboxamide (PubChem CID 91774545) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(3R,4R)-4-methoxyoxan-3-yl]pyrrole-2-carboxamide.
| Compound Name | 1-cyclopropyl-N-[(3R,4R)-4-methoxyoxan-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 91774545 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-cyclopropyl-N-[(3R,4R)-4-methoxyoxan-3-yl]pyrrole-2-carboxamide |
| SMILES | CO[C@@H]1CCOC[C@H]1NC(=O)c1cccn1C1CC1 |
| InChI | InChI=1S/C14H20N2O3/c1-18-13-6-8-19-9-11(13)15-14(17)12-3-2-7-16(12)10-4-5-10/h2-3,7,10-11,13H,4-6,8-9H2,1H3,(H,15,17)/t11-,13-/m1/s1 |
| InChIKey | PFSHOGTXTUOQNP-DGCLKSJQSA-N |
| XLogP | 1.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |