C22H24N2O3 — CID 91765488
1-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]indole-2-carboxamide (PubChem CID 91765488) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is 1-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 91765488 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-methyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@@H]2COCC[C@@H]2OCc2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c1-24-19-10-6-5-9-17(19)13-20(24)22(25)23-18-15-26-12-11-21(18)27-14-16-7-3-2-4-8-16/h2-10,13,18,21H,11-12,14-15H2,1H3,(H,23,25)/t18-,21+/m1/s1 |
| InChIKey | PYPYBOKKVHONAS-NQIIRXRSSA-N |
| XLogP | 3.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |