C22H21N3O4 — CID 15951678
ethyl 3-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]benzoate (PubChem CID 15951678) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is ethyl 3-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]benzoate.
| Compound Name | ethyl 3-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 15951678 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | ethyl 3-[(4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc3[nH]c4c(c3c2)C(C)CNC4=O)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-3-29-22(28)14-5-4-6-15(9-14)24-20(26)13-7-8-17-16(10-13)18-12(2)11-23-21(27)19(18)25-17/h4-10,12,25H,3,11H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | LHXHLXVGEPJZDV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|