C21H19N3O3 — CID 46851093
N-(4-acetylphenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (PubChem CID 46851093) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide.
| Compound Name | N-(4-acetylphenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 46851093 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(4-acetylphenyl)-4-methyl-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)C(C)CNC4=O)cc1 |
| InChI | InChI=1S/C21H19N3O3/c1-11-10-22-21(27)19-18(11)16-9-14(5-8-17(16)24-19)20(26)23-15-6-3-13(4-7-15)12(2)25/h3-9,11,24H,10H2,1-2H3,(H,22,27)(H,23,26) |
| InChIKey | KVJGHEKMQHNHIG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|