C21H19N3O4 — CID 58768502
methyl 4-[(1-methyl-4-oxo-1,2,3,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)amino]benzoate (PubChem CID 58768502) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is methyl 4-[(1-methyl-4-oxo-1,2,3,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(1-methyl-4-oxo-1,2,3,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 58768502 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl 4-[(1-methyl-4-oxo-1,2,3,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc3[nH]c4c(c3c2)C(C)NCC4=O)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-11-18-15-9-13(5-8-16(15)24-19(18)17(25)10-22-11)20(26)23-14-6-3-12(4-7-14)21(27)28-2/h3-9,11,22,24H,10H2,1-2H3,(H,23,26) |
| InChIKey | UTIAEQITOPIFFY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|