methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate

C12H11N3O4 — CID 43406982

IUPACmethyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2c[nH]c(=O)[nH]2)cc1
InChIInChI=1S/C12H11N3O4/c1-19-11(17)7-2-4-8(5-3-7)14-10(16)9-6-13-12(18)15-9/h2-6H,1H3,(H,14,16)(H2,13,15,18)
InChIKeyBMOKZDPMVFMWIE-UHFFFAOYSA-N
MW261.24 g/mol
LogP0.74
Rot. Bonds3

About methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate

methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate (PubChem CID 43406982) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate
PubChem CID43406982
Molecular FormulaC12H11N3O4
Molecular Weight261.24 g/mol
Exact Mass261.07
IUPAC Namemethyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2c[nH]c(=O)[nH]2)cc1
InChIInChI=1S/C12H11N3O4/c1-19-11(17)7-2-4-8(5-3-7)14-10(16)9-6-13-12(18)15-9/h2-6H,1H3,(H,14,16)(H2,13,15,18)
InChIKeyBMOKZDPMVFMWIE-UHFFFAOYSA-N
XLogP0.74
TPSA104.05 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.24
LogP ≤ 50.74
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate?
The IUPAC name of methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate (CID 43406982) is methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate.
What is the SMILES notation for methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate?
The canonical SMILES for methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate is COC(=O)c1ccc(NC(=O)c2c[nH]c(=O)[nH]2)cc1.
What is the InChIKey of methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate?
The InChIKey is BMOKZDPMVFMWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c1-19-11(17)7-2-4-8(5-3-7)14-10(16)9-6-13-12(18)15-9/h2-6H,1H3,(H,14,16)(H2,13,15,18).
What are the key properties of methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate?
methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate has a molecular weight of 261.24 g/mol, XLogP of 0.74, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]benzoate is sourced from PubChem (CID 43406982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).