C13H11N3O4 — CID 7185953
methyl 4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]benzoate (PubChem CID 7185953) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is methyl 4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 7185953 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | methyl 4-[(6-oxo-1H-pyridazine-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C13H11N3O4/c1-20-13(19)8-2-4-9(5-3-8)14-12(18)10-6-7-11(17)16-15-10/h2-7H,1H3,(H,14,18)(H,16,17) |
| InChIKey | JVHQOUVNSVKTQW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |