C13H12BrN3O2 — CID 114040990
N-[4-(2-bromoethyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 114040990) has the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. Its IUPAC name is N-[4-(2-bromoethyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[4-(2-bromoethyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 114040990 |
| Molecular Formula | C13H12BrN3O2 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | N-[4-(2-bromoethyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(CCBr)cc1)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C13H12BrN3O2/c14-8-7-9-1-3-10(4-2-9)15-13(19)11-5-6-12(18)17-16-11/h1-6H,7-8H2,(H,15,19)(H,17,18) |
| InChIKey | DKNMBADWBYWODL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|