C15H18N4O4S — CID 9415955
N-[4-(diethylsulfamoyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 9415955) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9415955 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C15H18N4O4S/c1-3-19(4-2)24(22,23)12-7-5-11(6-8-12)16-15(21)13-9-10-14(20)18-17-13/h5-10H,3-4H2,1-2H3,(H,16,21)(H,18,20) |
| InChIKey | YTASFHJPJXFXDE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |