methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate

C13H11N3O5 — CID 9396061

IUPACmethyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1
InChIInChI=1S/C13H11N3O5/c1-21-12(19)7-2-4-8(5-3-7)14-11(18)9-6-10(17)16-13(20)15-9/h2-6H,1H3,(H,14,18)(H2,15,16,17,20)
InChIKeyBGDUBPDTMRHGEO-UHFFFAOYSA-N
MW289.25 g/mol
LogP0.10
Rot. Bonds3

About methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate

methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate (PubChem CID 9396061) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate
PubChem CID9396061
Molecular FormulaC13H11N3O5
Molecular Weight289.25 g/mol
Exact Mass289.07
IUPAC Namemethyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1
InChIInChI=1S/C13H11N3O5/c1-21-12(19)7-2-4-8(5-3-7)14-11(18)9-6-10(17)16-13(20)15-9/h2-6H,1H3,(H,14,18)(H2,15,16,17,20)
InChIKeyBGDUBPDTMRHGEO-UHFFFAOYSA-N
XLogP0.10
TPSA121.12 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.25
LogP ≤ 50.10
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate?
The IUPAC name of methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate (CID 9396061) is methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate.
What is the SMILES notation for methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate?
The canonical SMILES for methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate is COC(=O)c1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1.
What is the InChIKey of methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate?
The InChIKey is BGDUBPDTMRHGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O5/c1-21-12(19)7-2-4-8(5-3-7)14-11(18)9-6-10(17)16-13(20)15-9/h2-6H,1H3,(H,14,18)(H2,15,16,17,20).
What are the key properties of methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate?
methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate has a molecular weight of 289.25 g/mol, XLogP of 0.10, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate is sourced from PubChem (CID 9396061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).