C13H11N3O5 — CID 9396061
methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate (PubChem CID 9396061) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 9396061 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | methyl 4-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H11N3O5/c1-21-12(19)7-2-4-8(5-3-7)14-11(18)9-6-10(17)16-13(20)15-9/h2-6H,1H3,(H,14,18)(H2,15,16,17,20) |
| InChIKey | BGDUBPDTMRHGEO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |