C11H8IN3O3 — CID 60636479
N-(4-iodophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 60636479) has the molecular formula C11H8IN3O3 and a molecular weight of 357.11 g/mol. Its IUPAC name is N-(4-iodophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(4-iodophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 60636479 |
| Molecular Formula | C11H8IN3O3 |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | N-(4-iodophenyl)-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H8IN3O3/c12-6-1-3-7(4-2-6)13-10(17)8-5-9(16)15-11(18)14-8/h1-5H,(H,13,17)(H2,14,15,16,18) |
| InChIKey | BODBGIQBZUHERJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|